C10H17N3O2 — CID 104523331
ethyl 1-(1-amino-2-methylpropan-2-yl)pyrazole-4-carboxylate (PubChem CID 104523331) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl 1-(1-amino-2-methylpropan-2-yl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(1-amino-2-methylpropan-2-yl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 104523331 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | ethyl 1-(1-amino-2-methylpropan-2-yl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C(C)(C)CN)c1 |
| InChI | InChI=1S/C10H17N3O2/c1-4-15-9(14)8-5-12-13(6-8)10(2,3)7-11/h5-6H,4,7,11H2,1-3H3 |
| InChIKey | XNOYUDCQJKVBQN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |