C8H15N3O2S — CID 165472927
2-methyl-2-(4-methylsulfonylpyrazol-1-yl)propan-1-amine (PubChem CID 165472927) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-methyl-2-(4-methylsulfonylpyrazol-1-yl)propan-1-amine.
| Compound Name | 2-methyl-2-(4-methylsulfonylpyrazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 165472927 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-methyl-2-(4-methylsulfonylpyrazol-1-yl)propan-1-amine |
| SMILES | CC(C)(CN)n1cc(S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C8H15N3O2S/c1-8(2,6-9)11-5-7(4-10-11)14(3,12)13/h4-5H,6,9H2,1-3H3 |
| InChIKey | LOMZMWDRPZJIEA-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |