C11H19BrN2O2S — CID 165480416
1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-methylsulfonylpyrazole (PubChem CID 165480416) has the molecular formula C11H19BrN2O2S and a molecular weight of 323.26 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-methylsulfonylpyrazole.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-methylsulfonylpyrazole |
|---|---|
| PubChem CID | 165480416 |
| Molecular Formula | C11H19BrN2O2S |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-4-methylsulfonylpyrazole |
| SMILES | CC(C)(C)C(CBr)Cn1cc(S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C11H19BrN2O2S/c1-11(2,3)9(5-12)7-14-8-10(6-13-14)17(4,15)16/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | JJQFFHIRNRHYAD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|