C7H12N2O3S — CID 165472464
(2R)-1-(4-methylsulfonylpyrazol-1-yl)propan-2-ol (PubChem CID 165472464) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is (2R)-1-(4-methylsulfonylpyrazol-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(4-methylsulfonylpyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 165472464 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (2R)-1-(4-methylsulfonylpyrazol-1-yl)propan-2-ol |
| SMILES | C[C@@H](O)Cn1cc(S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C7H12N2O3S/c1-6(10)4-9-5-7(3-8-9)13(2,11)12/h3,5-6,10H,4H2,1-2H3/t6-/m1/s1 |
| InChIKey | NATCZIZEGKWIOS-ZCFIWIBFSA-N |
| XLogP | -0.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |