C11H19N3O2S — CID 165471759
1-cyclopentyl-2-(4-methylsulfonylpyrazol-1-yl)ethanamine (PubChem CID 165471759) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-cyclopentyl-2-(4-methylsulfonylpyrazol-1-yl)ethanamine.
| Compound Name | 1-cyclopentyl-2-(4-methylsulfonylpyrazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 165471759 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-cyclopentyl-2-(4-methylsulfonylpyrazol-1-yl)ethanamine |
| SMILES | CS(=O)(=O)c1cnn(CC(N)C2CCCC2)c1 |
| InChI | InChI=1S/C11H19N3O2S/c1-17(15,16)10-6-13-14(7-10)8-11(12)9-4-2-3-5-9/h6-7,9,11H,2-5,8,12H2,1H3 |
| InChIKey | JNEPRRPVIKIVEC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |