C12H14N2O4S2 — CID 154786420
4-methylsulfonyl-1-[(4-methylsulfonylphenyl)methyl]pyrazole (PubChem CID 154786420) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-methylsulfonyl-1-[(4-methylsulfonylphenyl)methyl]pyrazole.
| Compound Name | 4-methylsulfonyl-1-[(4-methylsulfonylphenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 154786420 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-methylsulfonyl-1-[(4-methylsulfonylphenyl)methyl]pyrazole |
| SMILES | CS(=O)(=O)c1ccc(Cn2cc(S(C)(=O)=O)cn2)cc1 |
| InChI | InChI=1S/C12H14N2O4S2/c1-19(15,16)11-5-3-10(4-6-11)8-14-9-12(7-13-14)20(2,17)18/h3-7,9H,8H2,1-2H3 |
| InChIKey | AYNVNBVZZPMRQP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |