C11H15N3O3S — CID 165481352
N-methyl-1-[5-[(4-methylsulfonylpyrazol-1-yl)methyl]furan-2-yl]methanamine (PubChem CID 165481352) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is N-methyl-1-[5-[(4-methylsulfonylpyrazol-1-yl)methyl]furan-2-yl]methanamine.
| Compound Name | N-methyl-1-[5-[(4-methylsulfonylpyrazol-1-yl)methyl]furan-2-yl]methanamine |
|---|---|
| PubChem CID | 165481352 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-methyl-1-[5-[(4-methylsulfonylpyrazol-1-yl)methyl]furan-2-yl]methanamine |
| SMILES | CNCc1ccc(Cn2cc(S(C)(=O)=O)cn2)o1 |
| InChI | InChI=1S/C11H15N3O3S/c1-12-5-9-3-4-10(17-9)7-14-8-11(6-13-14)18(2,15)16/h3-4,6,8,12H,5,7H2,1-2H3 |
| InChIKey | GHGHFPVYFJODHG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |