C22H27N3O5S — CID 146797793
1-[(2R)-2-hydroxypropyl]-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-4-sulfonamide (PubChem CID 146797793) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxypropyl]-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-[(2R)-2-hydroxypropyl]-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 146797793 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[(2R)-2-hydroxypropyl]-N,N-bis[(4-methoxyphenyl)methyl]pyrazole-4-sulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2cnn(C[C@@H](C)O)c2)cc1 |
| InChI | InChI=1S/C22H27N3O5S/c1-17(26)13-24-16-22(12-23-24)31(27,28)25(14-18-4-8-20(29-2)9-5-18)15-19-6-10-21(30-3)11-7-19/h4-12,16-17,26H,13-15H2,1-3H3/t17-/m1/s1 |
| InChIKey | RXFBZQMPLVGTMA-QGZVFWFLSA-N |
| XLogP | 2.67 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |