C24H28N2O4S — CID 155068946
N,N-bis[(4-methoxyphenyl)methyl]-2-propan-2-ylpyridine-4-sulfonamide (PubChem CID 155068946) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is N,N-bis[(4-methoxyphenyl)methyl]-2-propan-2-ylpyridine-4-sulfonamide.
| Compound Name | N,N-bis[(4-methoxyphenyl)methyl]-2-propan-2-ylpyridine-4-sulfonamide |
|---|---|
| PubChem CID | 155068946 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N,N-bis[(4-methoxyphenyl)methyl]-2-propan-2-ylpyridine-4-sulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2ccnc(C(C)C)c2)cc1 |
| InChI | InChI=1S/C24H28N2O4S/c1-18(2)24-15-23(13-14-25-24)31(27,28)26(16-19-5-9-21(29-3)10-6-19)17-20-7-11-22(30-4)12-8-20/h5-15,18H,16-17H2,1-4H3 |
| InChIKey | YYJDHLYZYJPDSR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |