C22H23FN2O4S — CID 178149371
5-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-methylpyridine-2-sulfonamide (PubChem CID 178149371) has the molecular formula C22H23FN2O4S and a molecular weight of 430.50 g/mol. Its IUPAC name is 5-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-methylpyridine-2-sulfonamide.
| Compound Name | 5-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-methylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 178149371 |
| Molecular Formula | C22H23FN2O4S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 5-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-methylpyridine-2-sulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2ncc(F)cc2C)cc1 |
| InChI | InChI=1S/C22H23FN2O4S/c1-16-12-19(23)13-24-22(16)30(26,27)25(14-17-4-8-20(28-2)9-5-17)15-18-6-10-21(29-3)11-7-18/h4-13H,14-15H2,1-3H3 |
| InChIKey | QTTKSMGFIKDBBC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |