About (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane
(1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane (PubChem CID 157369569) has the molecular formula C9H16N2OS
and a molecular weight of 200.31 g/mol. Its IUPAC name is (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane |
| PubChem CID | 157369569 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane |
| SMILES | C=S(C)(=O)c1cnn(C(C)(C)C)c1 |
| InChI | InChI=1S/C9H16N2OS/c1-9(2,3)11-7-8(6-10-11)13(4,5)12/h6-7H,4H2,1-3,5H3 |
| InChIKey | WRIVOOGQHSKYSE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane?
The IUPAC name of (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane (CID 157369569) is (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane.
What is the SMILES notation for (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane?
The canonical SMILES for (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane is C=S(C)(=O)c1cnn(C(C)(C)C)c1.
What is the InChIKey of (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane?
The InChIKey is WRIVOOGQHSKYSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2OS/c1-9(2,3)11-7-8(6-10-11)13(4,5)12/h6-7H,4H2,1-3,5H3.
What are the key properties of (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane?
(1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane has a molecular weight of 200.31 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butylpyrazol-4-yl)-methyl-methylidene-oxo-λ6-sulfane is sourced from PubChem (CID 157369569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).