C21H23F3N6O10 — CID 136738133
[(2R,3S,4R,5R,6R)-6-(2-acetamido-6-oxo-1H-purin-7-yl)-3,4-diacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 136738133) has the molecular formula C21H23F3N6O10 and a molecular weight of 576.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-6-(2-acetamido-6-oxo-1H-purin-7-yl)-3,4-diacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-6-(2-acetamido-6-oxo-1H-purin-7-yl)-3,4-diacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 136738133 |
| Molecular Formula | C21H23F3N6O10 |
| Molecular Weight | 576.44 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-6-(2-acetamido-6-oxo-1H-purin-7-yl)-3,4-diacetyloxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)Nc1nc2ncn([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3NC(=O)C(F)(F)F)c2c(=O)[nH]1 |
| InChI | InChI=1S/C21H23F3N6O10/c1-7(31)26-20-28-16-13(17(35)29-20)30(6-25-16)18-12(27-19(36)21(22,23)24)15(39-10(4)34)14(38-9(3)33)11(40-18)5-37-8(2)32/h6,11-12,14-15,18H,5H2,1-4H3,(H,27,36)(H2,26,28,29,31,35)/t11-,12-,14-,15-,18-/m1/s1 |
| InChIKey | FBFPQSADGJSMRJ-AJKMGBEJSA-N |
| XLogP | -0.55 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.44 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|