C13H15FN6O5 — CID 153283002
1,2-diamino-9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynylpurine-6,8-dione (PubChem CID 153283002) has the molecular formula C13H15FN6O5 and a molecular weight of 354.30 g/mol. Its IUPAC name is 1,2-diamino-9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynylpurine-6,8-dione.
| Compound Name | 1,2-diamino-9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynylpurine-6,8-dione |
|---|---|
| PubChem CID | 153283002 |
| Molecular Formula | C13H15FN6O5 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1,2-diamino-9-[(2R,3S,4R,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynylpurine-6,8-dione |
| SMILES | C#CCn1c(=O)n([C@@H]2O[C@H](CO)[C@H](F)[C@H]2O)c2nc(N)n(N)c(=O)c21 |
| InChI | InChI=1S/C13H15FN6O5/c1-2-3-18-7-9(17-12(15)20(16)10(7)23)19(13(18)24)11-8(22)6(14)5(4-21)25-11/h1,5-6,8,11,21-22H,3-4,16H2,(H2,15,17)/t5-,6+,8-,11-/m1/s1 |
| InChIKey | MQQBHPAEOMHLJL-WCGPTHBMSA-N |
| XLogP | -3.12 |
| TPSA | 163.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|