C17H19N7O8 — CID 10072391
1,2-diamino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[(4-nitrophenyl)methyl]purine-6,8-dione (PubChem CID 10072391) has the molecular formula C17H19N7O8 and a molecular weight of 449.38 g/mol. Its IUPAC name is 1,2-diamino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[(4-nitrophenyl)methyl]purine-6,8-dione.
| Compound Name | 1,2-diamino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[(4-nitrophenyl)methyl]purine-6,8-dione |
|---|---|
| PubChem CID | 10072391 |
| Molecular Formula | C17H19N7O8 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 1,2-diamino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[(4-nitrophenyl)methyl]purine-6,8-dione |
| SMILES | Nc1nc2c(c(=O)n1N)n(Cc1ccc([N+](=O)[O-])cc1)c(=O)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H19N7O8/c18-16-20-13-10(14(28)23(16)19)21(5-7-1-3-8(4-2-7)24(30)31)17(29)22(13)15-12(27)11(26)9(6-25)32-15/h1-4,9,11-12,15,25-27H,5-6,19H2,(H2,18,20)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | DSBHPXLCXHUZHN-SDBHATRESA-N |
| XLogP | -2.78 |
| TPSA | 226.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|