C24H26N4O8 — CID 174463113
4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;ethene;(4-nitrophenyl)-phenylmethanone (PubChem CID 174463113) has the molecular formula C24H26N4O8 and a molecular weight of 498.49 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;ethene;(4-nitrophenyl)-phenylmethanone.
| Compound Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;ethene;(4-nitrophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 174463113 |
| Molecular Formula | C24H26N4O8 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;ethene;(4-nitrophenyl)-phenylmethanone |
| SMILES | C=C.Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9NO3.C9H13N3O5.C2H4/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8;1-2/h1-9H;1-2,4,6-8,13-15H,3H2,(H2,10,11,16);1-2H2/t;4-,6-,7-,8-;/m.1./s1 |
| InChIKey | PWOFZGHIWKYEGI-IOKZUZSRSA-N |
| XLogP | 1.07 |
| TPSA | 191.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|