C13H17N5O6 — CID 153027303
2-amino-9-[(2R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione (PubChem CID 153027303) has the molecular formula C13H17N5O6 and a molecular weight of 339.31 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione.
| Compound Name | 2-amino-9-[(2R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 153027303 |
| Molecular Formula | C13H17N5O6 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione |
| SMILES | C=CCn1c(=O)n([C@@H]2OC(CO)[C@@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C13H17N5O6/c1-2-3-17-6-9(15-12(14)16-10(6)22)18(13(17)23)11-8(21)7(20)5(4-19)24-11/h2,5,7-8,11,19-21H,1,3-4H2,(H3,14,15,16,22)/t5?,7-,8-,11-/m1/s1 |
| InChIKey | VDCRFBBZFHHYGT-YQYOSIFRSA-N |
| XLogP | -2.73 |
| TPSA | 168.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|