C20H22N6O6 — CID 136963310
9-[(3aR,6R,6aR)-2-(4-aminophenyl)-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-7-prop-2-enyl-1H-purine-6,8-dione (PubChem CID 136963310) has the molecular formula C20H22N6O6 and a molecular weight of 442.43 g/mol. Its IUPAC name is 9-[(3aR,6R,6aR)-2-(4-aminophenyl)-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-7-prop-2-enyl-1H-purine-6,8-dione.
| Compound Name | 9-[(3aR,6R,6aR)-2-(4-aminophenyl)-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-7-prop-2-enyl-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 136963310 |
| Molecular Formula | C20H22N6O6 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 9-[(3aR,6R,6aR)-2-(4-aminophenyl)-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-7-prop-2-enyl-1H-purine-6,8-dione |
| SMILES | C=CCn1c(=O)n(C2O[C@H](CO)[C@H]3OC(c4ccc(N)cc4)O[C@@H]23)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C20H22N6O6/c1-2-7-25-12-15(23-19(22)24-16(12)28)26(20(25)29)17-14-13(11(8-27)30-17)31-18(32-14)9-3-5-10(21)6-4-9/h2-6,11,13-14,17-18,27H,1,7-8,21H2,(H3,22,23,24,28)/t11-,13-,14-,17?,18?/m1/s1 |
| InChIKey | RZOZHFICTABSSQ-AXUMRRFASA-N |
| XLogP | -0.39 |
| TPSA | 172.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|