C12H17N5O9 — CID 170151668
2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(2,2,2-trihydroxyethyl)-1H-purine-6,8-dione (PubChem CID 170151668) has the molecular formula C12H17N5O9 and a molecular weight of 375.29 g/mol. Its IUPAC name is 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(2,2,2-trihydroxyethyl)-1H-purine-6,8-dione.
| Compound Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(2,2,2-trihydroxyethyl)-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 170151668 |
| Molecular Formula | C12H17N5O9 |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(2,2,2-trihydroxyethyl)-1H-purine-6,8-dione |
| SMILES | Nc1nc2c(c(=O)[nH]1)n(CC(O)(O)O)c(=O)n2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C12H17N5O9/c13-10-14-7-4(8(21)15-10)16(2-12(23,24)25)11(22)17(7)9-6(20)5(19)3(1-18)26-9/h3,5-6,9,18-20,23-25H,1-2H2,(H3,13,14,15,21) |
| InChIKey | YFXXQPJITJBETJ-UHFFFAOYSA-N |
| XLogP | -5.29 |
| TPSA | 229.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | -5.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|