C15H24N6O6 — CID 135531219
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[3-(dimethylamino)propyl]-1H-purine-6,8-dione (PubChem CID 135531219) has the molecular formula C15H24N6O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[3-(dimethylamino)propyl]-1H-purine-6,8-dione.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[3-(dimethylamino)propyl]-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 135531219 |
| Molecular Formula | C15H24N6O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-[3-(dimethylamino)propyl]-1H-purine-6,8-dione |
| SMILES | CN(C)CCCn1c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C15H24N6O6/c1-19(2)4-3-5-20-8-11(17-14(16)18-12(8)25)21(15(20)26)13-10(24)9(23)7(6-22)27-13/h7,9-10,13,22-24H,3-6H2,1-2H3,(H3,16,17,18,25)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | NXWPMUGNRSTPKV-QYVSTXNMSA-N |
| XLogP | -2.97 |
| TPSA | 171.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |