C19H22N8O7 — CID 136645113
[(2R,3R,4R,5R)-5-(2-amino-6,8-dioxo-7-prop-2-enyl-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 6-hydrazinylpyridine-3-carboxylate (PubChem CID 136645113) has the molecular formula C19H22N8O7 and a molecular weight of 474.43 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2-amino-6,8-dioxo-7-prop-2-enyl-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 6-hydrazinylpyridine-3-carboxylate.
| Compound Name | [(2R,3R,4R,5R)-5-(2-amino-6,8-dioxo-7-prop-2-enyl-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 6-hydrazinylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 136645113 |
| Molecular Formula | C19H22N8O7 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2-amino-6,8-dioxo-7-prop-2-enyl-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 6-hydrazinylpyridine-3-carboxylate |
| SMILES | C=CCn1c(=O)n([C@@H]2O[C@H](COC(=O)c3ccc(NN)nc3)[C@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C19H22N8O7/c1-2-5-26-11-14(23-18(20)24-15(11)30)27(19(26)32)16-13(29)12(28)9(34-16)7-33-17(31)8-3-4-10(25-21)22-6-8/h2-4,6,9,12-13,16,28-29H,1,5,7,21H2,(H,22,25)(H3,20,23,24,30)/t9-,12+,13-,16-/m1/s1 |
| InChIKey | RVAPEOZEKZSBGA-LYNPINBMSA-N |
| XLogP | -2.19 |
| TPSA | 225.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|