C20H24N8O6 — CID 136933062
[(1R,2R,3S,4R)-4-(2-amino-6,8-dioxo-7-prop-2-enyl-1H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl 6-hydrazinylpyridine-3-carboxylate (PubChem CID 136933062) has the molecular formula C20H24N8O6 and a molecular weight of 472.46 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-(2-amino-6,8-dioxo-7-prop-2-enyl-1H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl 6-hydrazinylpyridine-3-carboxylate.
| Compound Name | [(1R,2R,3S,4R)-4-(2-amino-6,8-dioxo-7-prop-2-enyl-1H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl 6-hydrazinylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 136933062 |
| Molecular Formula | C20H24N8O6 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [(1R,2R,3S,4R)-4-(2-amino-6,8-dioxo-7-prop-2-enyl-1H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl 6-hydrazinylpyridine-3-carboxylate |
| SMILES | C=CCn1c(=O)n([C@@H]2C[C@H](COC(=O)c3ccc(NN)nc3)[C@@H](O)[C@H]2O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C20H24N8O6/c1-2-5-27-13-16(24-19(21)25-17(13)31)28(20(27)33)11-6-10(14(29)15(11)30)8-34-18(32)9-3-4-12(26-22)23-7-9/h2-4,7,10-11,14-15,29-30H,1,5-6,8,22H2,(H,23,26)(H3,21,24,25,31)/t10-,11-,14-,15+/m1/s1 |
| InChIKey | MQEQTHDQWCLCLM-FKGLVLAHSA-N |
| XLogP | -1.53 |
| TPSA | 216.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|