C14H17N5O6 — CID 136609073
2-amino-9-[(1R,2R,4R,5R)-1,5-dihydroxy-4-(hydroxymethyl)-3-oxabicyclo[3.1.0]hexan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione (PubChem CID 136609073) has the molecular formula C14H17N5O6 and a molecular weight of 351.32 g/mol. Its IUPAC name is 2-amino-9-[(1R,2R,4R,5R)-1,5-dihydroxy-4-(hydroxymethyl)-3-oxabicyclo[3.1.0]hexan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione.
| Compound Name | 2-amino-9-[(1R,2R,4R,5R)-1,5-dihydroxy-4-(hydroxymethyl)-3-oxabicyclo[3.1.0]hexan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 136609073 |
| Molecular Formula | C14H17N5O6 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-amino-9-[(1R,2R,4R,5R)-1,5-dihydroxy-4-(hydroxymethyl)-3-oxabicyclo[3.1.0]hexan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione |
| SMILES | C=CCn1c(=O)n([C@@H]2O[C@H](CO)[C@]3(O)C[C@]23O)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C14H17N5O6/c1-2-3-18-7-8(16-11(15)17-9(7)21)19(12(18)22)10-14(24)5-13(14,23)6(4-20)25-10/h2,6,10,20,23-24H,1,3-5H2,(H3,15,16,17,21)/t6-,10-,13-,14+/m1/s1 |
| InChIKey | FNIVMWSTDPRAET-IHIUCLBOSA-N |
| XLogP | -2.59 |
| TPSA | 168.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|