C12H14F3N5O5 — CID 150911370
2-amino-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(2,2,2-trifluoroethyl)-1H-purine-6,8-dione (PubChem CID 150911370) has the molecular formula C12H14F3N5O5 and a molecular weight of 365.27 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(2,2,2-trifluoroethyl)-1H-purine-6,8-dione.
| Compound Name | 2-amino-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(2,2,2-trifluoroethyl)-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 150911370 |
| Molecular Formula | C12H14F3N5O5 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-amino-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(2,2,2-trifluoroethyl)-1H-purine-6,8-dione |
| SMILES | Nc1nc2c(c(=O)[nH]1)n(CC(F)(F)F)c(=O)n2[C@@H]1O[C@H](CO)C[C@H]1O |
| InChI | InChI=1S/C12H14F3N5O5/c13-12(14,15)3-19-6-7(17-10(16)18-8(6)23)20(11(19)24)9-5(22)1-4(2-21)25-9/h4-5,9,21-22H,1-3H2,(H3,16,17,18,23)/t4-,5+,9+/m0/s1 |
| InChIKey | LCBDQYSCQFRROW-OBXARNEKSA-N |
| XLogP | -1.33 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |