C16H21F4N5O4 — CID 158819365
2-amino-9-[(2R,3S,4R,5R)-4-fluoro-5-[(1S)-1-hydroxypropyl]-3-methyloxolan-2-yl]-7-(3,3,3-trifluoropropyl)-1H-purine-6,8-dione (PubChem CID 158819365) has the molecular formula C16H21F4N5O4 and a molecular weight of 423.37 g/mol. Its IUPAC name is 2-amino-9-[(2R,3S,4R,5R)-4-fluoro-5-[(1S)-1-hydroxypropyl]-3-methyloxolan-2-yl]-7-(3,3,3-trifluoropropyl)-1H-purine-6,8-dione.
| Compound Name | 2-amino-9-[(2R,3S,4R,5R)-4-fluoro-5-[(1S)-1-hydroxypropyl]-3-methyloxolan-2-yl]-7-(3,3,3-trifluoropropyl)-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 158819365 |
| Molecular Formula | C16H21F4N5O4 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-amino-9-[(2R,3S,4R,5R)-4-fluoro-5-[(1S)-1-hydroxypropyl]-3-methyloxolan-2-yl]-7-(3,3,3-trifluoropropyl)-1H-purine-6,8-dione |
| SMILES | CC[C@H](O)[C@H]1O[C@@H](n2c(=O)n(CCC(F)(F)F)c3c(=O)[nH]c(N)nc32)[C@H](C)[C@H]1F |
| InChI | InChI=1S/C16H21F4N5O4/c1-3-7(26)10-8(17)6(2)13(29-10)25-11-9(12(27)23-14(21)22-11)24(15(25)28)5-4-16(18,19)20/h6-8,10,13,26H,3-5H2,1-2H3,(H3,21,22,23,27)/t6-,7+,8-,10-,13-/m1/s1 |
| InChIKey | XCYOPHIUOSXKLS-HBSQLLDTSA-N |
| XLogP | 1.06 |
| TPSA | 128.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |