C12H14FN5O5 — CID 152660755
2-[2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-oxopurin-7-yl]acetaldehyde (PubChem CID 152660755) has the molecular formula C12H14FN5O5 and a molecular weight of 327.27 g/mol. Its IUPAC name is 2-[2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-oxopurin-7-yl]acetaldehyde.
| Compound Name | 2-[2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-oxopurin-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 152660755 |
| Molecular Formula | C12H14FN5O5 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-oxopurin-7-yl]acetaldehyde |
| SMILES | Nc1ncc2c(n1)n([C@@H]1O[C@H](CO)[C@@H](F)[C@H]1O)c(=O)n2CC=O |
| InChI | InChI=1S/C12H14FN5O5/c13-7-6(4-20)23-10(8(7)21)18-9-5(3-15-11(14)16-9)17(1-2-19)12(18)22/h2-3,6-8,10,20-21H,1,4H2,(H2,14,15,16)/t6-,7-,8-,10-/m1/s1 |
| InChIKey | ZJMQPFZJBHIJBJ-FDDDBJFASA-N |
| XLogP | -2.04 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|