C17H19N5O4 — CID 150393970
2-amino-7-benzyl-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-one (PubChem CID 150393970) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-amino-7-benzyl-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-one.
| Compound Name | 2-amino-7-benzyl-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-one |
|---|---|
| PubChem CID | 150393970 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-amino-7-benzyl-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-one |
| SMILES | Nc1ncc2c(n1)n([C@@H]1O[C@H](CO)C[C@H]1O)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C17H19N5O4/c18-16-19-7-12-14(20-16)22(15-13(24)6-11(9-23)26-15)17(25)21(12)8-10-4-2-1-3-5-10/h1-5,7,11,13,15,23-24H,6,8-9H2,(H2,18,19,20)/t11-,13+,15+/m0/s1 |
| InChIKey | HCHKFRNKOBOQES-NJZAAPMLSA-N |
| XLogP | -0.14 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |