C18H19N5O5 — CID 151127911
4-[[2-amino-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-oxopurin-7-yl]methyl]benzaldehyde (PubChem CID 151127911) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 4-[[2-amino-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-oxopurin-7-yl]methyl]benzaldehyde.
| Compound Name | 4-[[2-amino-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-oxopurin-7-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 151127911 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-[[2-amino-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-oxopurin-7-yl]methyl]benzaldehyde |
| SMILES | Nc1ncc2c(n1)n([C@@H]1O[C@H](CO)C[C@H]1O)c(=O)n2Cc1ccc(C=O)cc1 |
| InChI | InChI=1S/C18H19N5O5/c19-17-20-6-13-15(21-17)23(16-14(26)5-12(9-25)28-16)18(27)22(13)7-10-1-3-11(8-24)4-2-10/h1-4,6,8,12,14,16,25-26H,5,7,9H2,(H2,19,20,21)/t12-,14+,16+/m0/s1 |
| InChIKey | MTPBREMXXRHHKI-JGGQBBKZSA-N |
| XLogP | -0.32 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|