C10H12N4O5S — CID 71273177
5-amino-3-[(2R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[4,5-d]pyrimidin-2-one (PubChem CID 71273177) has the molecular formula C10H12N4O5S and a molecular weight of 300.30 g/mol. Its IUPAC name is 5-amino-3-[(2R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[4,5-d]pyrimidin-2-one.
| Compound Name | 5-amino-3-[(2R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 71273177 |
| Molecular Formula | C10H12N4O5S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 5-amino-3-[(2R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
| SMILES | Nc1ncc2sc(=O)n([C@@H]3O[C@H](CO)[C@@H](O)C3O)c2n1 |
| InChI | InChI=1S/C10H12N4O5S/c11-9-12-1-4-7(13-9)14(10(18)20-4)8-6(17)5(16)3(2-15)19-8/h1,3,5-6,8,15-17H,2H2,(H2,11,12,13)/t3-,5-,6?,8-/m1/s1 |
| InChIKey | BBLQSWGGUCEGTH-SAAKZLLZSA-N |
| XLogP | -1.95 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |