C12H17N5O5S — CID 10215379
5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(dimethylamino)-[1,3]thiazolo[4,5-d]pyrimidin-2-one (PubChem CID 10215379) has the molecular formula C12H17N5O5S and a molecular weight of 343.37 g/mol. Its IUPAC name is 5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(dimethylamino)-[1,3]thiazolo[4,5-d]pyrimidin-2-one.
| Compound Name | 5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(dimethylamino)-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 10215379 |
| Molecular Formula | C12H17N5O5S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-(dimethylamino)-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
| SMILES | CN(C)c1nc(N)nc2c1sc(=O)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H17N5O5S/c1-16(2)8-7-9(15-11(13)14-8)17(12(21)23-7)10-6(20)5(19)4(3-18)22-10/h4-6,10,18-20H,3H2,1-2H3,(H2,13,14,15)/t4-,5-,6-,10-/m1/s1 |
| InChIKey | XRPZITYQBYJQIQ-PLDPKQSISA-N |
| XLogP | -1.89 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |