C20H30N6O6S — CID 10195657
[(2R,3S,4R,5R)-5-[5-amino-7-(cyclopentylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 10195657) has the molecular formula C20H30N6O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-amino-7-(cyclopentylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-[5-amino-7-(cyclopentylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 10195657 |
| Molecular Formula | C20H30N6O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-amino-7-(cyclopentylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OC[C@H]1O[C@@H](n2c(=O)sc3c(NC4CCCC4)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H30N6O6S/c1-8(2)11(21)18(29)31-7-10-12(27)13(28)17(32-10)26-16-14(33-20(26)30)15(24-19(22)25-16)23-9-5-3-4-6-9/h8-13,17,27-28H,3-7,21H2,1-2H3,(H3,22,23,24,25)/t10-,11+,12-,13-,17-/m1/s1 |
| InChIKey | DPUXIGBFVUEGTB-QMZWZUABSA-N |
| XLogP | -0.06 |
| TPSA | 187.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |