C17H20BrCl2N3O5 — CID 11467618
[(2R,3S,4R,5R)-5-(2-bromo-5,6-dichlorobenzimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 11467618) has the molecular formula C17H20BrCl2N3O5 and a molecular weight of 497.17 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-bromo-5,6-dichlorobenzimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-bromo-5,6-dichlorobenzimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 11467618 |
| Molecular Formula | C17H20BrCl2N3O5 |
| Molecular Weight | 497.17 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-bromo-5,6-dichlorobenzimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OC[C@H]1O[C@@H](n2c(Br)nc3cc(Cl)c(Cl)cc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H20BrCl2N3O5/c1-6(2)12(21)16(26)27-5-11-13(24)14(25)15(28-11)23-10-4-8(20)7(19)3-9(10)22-17(23)18/h3-4,6,11-15,24-25H,5,21H2,1-2H3/t11-,12+,13-,14-,15-/m1/s1 |
| InChIKey | SOUOYGLAJHYXES-XLWJZTARSA-N |
| XLogP | 2.25 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |