C15H18Cl3N3O3 — CID 70022413
(2R,3R,4S,5S)-2-(chloromethyl)-5-[5,6-dichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol (PubChem CID 70022413) has the molecular formula C15H18Cl3N3O3 and a molecular weight of 394.69 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(chloromethyl)-5-[5,6-dichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(chloromethyl)-5-[5,6-dichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70022413 |
| Molecular Formula | C15H18Cl3N3O3 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | (2R,3R,4S,5S)-2-(chloromethyl)-5-[5,6-dichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol |
| SMILES | CC(C)Nc1nc2cc(Cl)c(Cl)cc2n1[C@H]1O[C@@H](CCl)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H18Cl3N3O3/c1-6(2)19-15-20-9-3-7(17)8(18)4-10(9)21(15)14-13(23)12(22)11(5-16)24-14/h3-4,6,11-14,22-23H,5H2,1-2H3,(H,19,20)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | MAJUZBSNBQOBKK-XUXIUFHCSA-N |
| XLogP | 3.02 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|