C15H18Cl3N3O4 — CID 70022379
(3R,4S,5S)-2-(hydroxymethyl)-5-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol (PubChem CID 70022379) has the molecular formula C15H18Cl3N3O4 and a molecular weight of 410.69 g/mol. Its IUPAC name is (3R,4S,5S)-2-(hydroxymethyl)-5-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol.
| Compound Name | (3R,4S,5S)-2-(hydroxymethyl)-5-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70022379 |
| Molecular Formula | C15H18Cl3N3O4 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | (3R,4S,5S)-2-(hydroxymethyl)-5-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol |
| SMILES | CC(C)Nc1nc2c(Cl)c(Cl)c(Cl)cc2n1[C@H]1OC(CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H18Cl3N3O4/c1-5(2)19-15-20-11-7(3-6(16)9(17)10(11)18)21(15)14-13(24)12(23)8(4-22)25-14/h3,5,8,12-14,22-24H,4H2,1-2H3,(H,19,20)/t8?,12-,13-,14-/m0/s1 |
| InChIKey | YJZSOQRJUHPBRJ-WJAXLFQTSA-N |
| XLogP | 2.43 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|