C12H10BrCl3N2O3 — CID 516055
(2S,3S,4R,5R)-2-(bromomethyl)-5-(2,5,6-trichlorobenzimidazol-1-yl)oxolane-3,4-diol (PubChem CID 516055) has the molecular formula C12H10BrCl3N2O3 and a molecular weight of 416.49 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(bromomethyl)-5-(2,5,6-trichlorobenzimidazol-1-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-(bromomethyl)-5-(2,5,6-trichlorobenzimidazol-1-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 516055 |
| Molecular Formula | C12H10BrCl3N2O3 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 413.89 |
| IUPAC Name | (2S,3S,4R,5R)-2-(bromomethyl)-5-(2,5,6-trichlorobenzimidazol-1-yl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](CBr)O[C@H]1n1c(Cl)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C12H10BrCl3N2O3/c13-3-8-9(19)10(20)11(21-8)18-7-2-5(15)4(14)1-6(7)17-12(18)16/h1-2,8-11,19-20H,3H2/t8-,9-,10-,11-/m1/s1 |
| InChIKey | VGJBABRJAXMGPI-GWOFURMSSA-N |
| XLogP | 3.01 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|