C16H19Cl3N2O4 — CID 516052
(2R,3S,4R,5R)-2-(butoxymethyl)-5-(2,5,6-trichlorobenzimidazol-1-yl)oxolane-3,4-diol (PubChem CID 516052) has the molecular formula C16H19Cl3N2O4 and a molecular weight of 409.70 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(butoxymethyl)-5-(2,5,6-trichlorobenzimidazol-1-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(butoxymethyl)-5-(2,5,6-trichlorobenzimidazol-1-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 516052 |
| Molecular Formula | C16H19Cl3N2O4 |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | (2R,3S,4R,5R)-2-(butoxymethyl)-5-(2,5,6-trichlorobenzimidazol-1-yl)oxolane-3,4-diol |
| SMILES | CCCCOC[C@H]1O[C@@H](n2c(Cl)nc3cc(Cl)c(Cl)cc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19Cl3N2O4/c1-2-3-4-24-7-12-13(22)14(23)15(25-12)21-11-6-9(18)8(17)5-10(11)20-16(21)19/h5-6,12-15,22-23H,2-4,7H2,1H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | DBSYFNJEICYWMS-KBUPBQIOSA-N |
| XLogP | 3.43 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|