C17H18BrCl2N3O5 — CID 11456255
[(2R,3S,4R,5R)-5-(2-bromo-5,6-dichlorobenzimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-pyrrolidine-2-carboxylate (PubChem CID 11456255) has the molecular formula C17H18BrCl2N3O5 and a molecular weight of 495.16 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-bromo-5,6-dichlorobenzimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-bromo-5,6-dichlorobenzimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11456255 |
| Molecular Formula | C17H18BrCl2N3O5 |
| Molecular Weight | 495.16 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-bromo-5,6-dichlorobenzimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2c(Br)nc3cc(Cl)c(Cl)cc32)[C@H](O)[C@@H]1O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C17H18BrCl2N3O5/c18-17-22-10-4-7(19)8(20)5-11(10)23(17)15-14(25)13(24)12(28-15)6-27-16(26)9-2-1-3-21-9/h4-5,9,12-15,21,24-25H,1-3,6H2/t9-,12+,13+,14+,15+/m0/s1 |
| InChIKey | JAMOJPAGZNMVBP-JZLHEVAFSA-N |
| XLogP | 2.02 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |