C18H18Cl3NO6 — CID 141114602
[(2R,3S,4R)-3,4-dihydroxy-5-(2,5,6-trichloro-3-formylindol-1-yl)oxolan-2-yl]methyl 2-deuteriobutanoate (PubChem CID 141114602) has the molecular formula C18H18Cl3NO6 and a molecular weight of 451.71 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-dihydroxy-5-(2,5,6-trichloro-3-formylindol-1-yl)oxolan-2-yl]methyl 2-deuteriobutanoate.
| Compound Name | [(2R,3S,4R)-3,4-dihydroxy-5-(2,5,6-trichloro-3-formylindol-1-yl)oxolan-2-yl]methyl 2-deuteriobutanoate |
|---|---|
| PubChem CID | 141114602 |
| Molecular Formula | C18H18Cl3NO6 |
| Molecular Weight | 451.71 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | [(2R,3S,4R)-3,4-dihydroxy-5-(2,5,6-trichloro-3-formylindol-1-yl)oxolan-2-yl]methyl 2-deuteriobutanoate |
| SMILES | [2H]C(CC)C(=O)OC[C@H]1OC(n2c(Cl)c(C=O)c3cc(Cl)c(Cl)cc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H18Cl3NO6/c1-2-3-14(24)27-7-13-15(25)16(26)18(28-13)22-12-5-11(20)10(19)4-8(12)9(6-23)17(22)21/h4-6,13,15-16,18,25-26H,2-3,7H2,1H3/t13-,15-,16-,18?/m1/s1/i3D/t3?,13-,15-,16-,18? |
| InChIKey | ZRHXENMBXGMLQR-PNXAALFKSA-N |
| XLogP | 3.38 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|