C16H14Cl3NO6 — CID 3012567
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2,5,6-trichloro-3-formylindol-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 3012567) has the molecular formula C16H14Cl3NO6 and a molecular weight of 422.65 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(2,5,6-trichloro-3-formylindol-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(2,5,6-trichloro-3-formylindol-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3012567 |
| Molecular Formula | C16H14Cl3NO6 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(2,5,6-trichloro-3-formylindol-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(Cl)c(C=O)c3cc(Cl)c(Cl)cc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H14Cl3NO6/c1-6(22)25-5-12-13(23)14(24)16(26-12)20-11-3-10(18)9(17)2-7(11)8(4-21)15(20)19/h2-4,12-14,16,23-24H,5H2,1H3/t12-,13-,14-,16-/m1/s1 |
| InChIKey | IWWRQXBJTJDXFB-IXYNUQLISA-N |
| XLogP | 2.60 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|