C16H18Cl3N3O4 — CID 58354147
2-(hydroxymethyl)-5-[2,5,6-trichloro-3-[(dimethylhydrazinylidene)methyl]indol-1-yl]oxolane-3,4-diol (PubChem CID 58354147) has the molecular formula C16H18Cl3N3O4 and a molecular weight of 422.70 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-[2,5,6-trichloro-3-[(dimethylhydrazinylidene)methyl]indol-1-yl]oxolane-3,4-diol.
| Compound Name | 2-(hydroxymethyl)-5-[2,5,6-trichloro-3-[(dimethylhydrazinylidene)methyl]indol-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 58354147 |
| Molecular Formula | C16H18Cl3N3O4 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 2-(hydroxymethyl)-5-[2,5,6-trichloro-3-[(dimethylhydrazinylidene)methyl]indol-1-yl]oxolane-3,4-diol |
| SMILES | CN(C)N=Cc1c(Cl)n(C2OC(CO)C(O)C2O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C16H18Cl3N3O4/c1-21(2)20-5-8-7-3-9(17)10(18)4-11(7)22(15(8)19)16-14(25)13(24)12(6-23)26-16/h3-5,12-14,16,23-25H,6H2,1-2H3 |
| InChIKey | SLOWIEFADADHMU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|