C12H12Cl2N2O4S — CID 91232511
5,6-dichloro-3-[(2R,3S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-benzimidazole-2-thione (PubChem CID 91232511) has the molecular formula C12H12Cl2N2O4S and a molecular weight of 351.21 g/mol. Its IUPAC name is 5,6-dichloro-3-[(2R,3S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-benzimidazole-2-thione.
| Compound Name | 5,6-dichloro-3-[(2R,3S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 91232511 |
| Molecular Formula | C12H12Cl2N2O4S |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 5,6-dichloro-3-[(2R,3S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-benzimidazole-2-thione |
| SMILES | OC[C@@H]1O[C@@H](n2c(=S)[nH]c3cc(Cl)c(Cl)cc32)[C@@H](O)C1O |
| InChI | InChI=1S/C12H12Cl2N2O4S/c13-4-1-6-7(2-5(4)14)16(12(21)15-6)11-10(19)9(18)8(3-17)20-11/h1-2,8-11,17-19H,3H2,(H,15,21)/t8-,9?,10-,11+/m0/s1 |
| InChIKey | ZWYUQPPTOOZWEF-OFLUOSHYSA-N |
| XLogP | 1.62 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|