C17H20Cl3NO6 — CID 67990838
(2R,5R)-2-(hydroxymethyl)-5-[2,5,6-trichloro-3-(2,2-dimethoxyethyl)indol-1-yl]oxolane-3,4-diol (PubChem CID 67990838) has the molecular formula C17H20Cl3NO6 and a molecular weight of 440.71 g/mol. Its IUPAC name is (2R,5R)-2-(hydroxymethyl)-5-[2,5,6-trichloro-3-(2,2-dimethoxyethyl)indol-1-yl]oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(hydroxymethyl)-5-[2,5,6-trichloro-3-(2,2-dimethoxyethyl)indol-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67990838 |
| Molecular Formula | C17H20Cl3NO6 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | (2R,5R)-2-(hydroxymethyl)-5-[2,5,6-trichloro-3-(2,2-dimethoxyethyl)indol-1-yl]oxolane-3,4-diol |
| SMILES | COC(Cc1c(Cl)n([C@@H]2O[C@H](CO)C(O)C2O)c2cc(Cl)c(Cl)cc12)OC |
| InChI | InChI=1S/C17H20Cl3NO6/c1-25-13(26-2)4-8-7-3-9(18)10(19)5-11(7)21(16(8)20)17-15(24)14(23)12(6-22)27-17/h3,5,12-15,17,22-24H,4,6H2,1-2H3/t12-,14?,15?,17-/m1/s1 |
| InChIKey | ARMAZDPICUHWPA-IGHZYHEGSA-N |
| XLogP | 2.37 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|