C16H16Cl3N3O5 — CID 46877281
N-[(E)-[2,5,6-trichloro-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]indol-3-yl]methylideneamino]acetamide (PubChem CID 46877281) has the molecular formula C16H16Cl3N3O5 and a molecular weight of 436.68 g/mol. Its IUPAC name is N-[(E)-[2,5,6-trichloro-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]indol-3-yl]methylideneamino]acetamide.
| Compound Name | N-[(E)-[2,5,6-trichloro-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]indol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 46877281 |
| Molecular Formula | C16H16Cl3N3O5 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | N-[(E)-[2,5,6-trichloro-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]indol-3-yl]methylideneamino]acetamide |
| SMILES | CC(=O)N/N=C/c1c(Cl)n(C2O[C@H](CO)[C@@H](O)[C@H]2O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C16H16Cl3N3O5/c1-6(24)21-20-4-8-7-2-9(17)10(18)3-11(7)22(15(8)19)16-14(26)13(25)12(5-23)27-16/h2-4,12-14,16,23,25-26H,5H2,1H3,(H,21,24)/b20-4+/t12-,13-,14-,16?/m1/s1 |
| InChIKey | YZEOGUDFUWSXFB-QNCNPAPKSA-N |
| XLogP | 1.68 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|