C15H13Cl2NO7 — CID 100926517
6,7-dichloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 100926517) has the molecular formula C15H13Cl2NO7 and a molecular weight of 390.18 g/mol. Its IUPAC name is 6,7-dichloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6,7-dichloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 100926517 |
| Molecular Formula | C15H13Cl2NO7 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 6,7-dichloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2cc(Cl)c(Cl)cc2c1=O |
| InChI | InChI=1S/C15H13Cl2NO7/c16-7-1-5-9(2-8(7)17)18(3-6(11(5)20)15(23)24)14-13(22)12(21)10(4-19)25-14/h1-3,10,12-14,19,21-22H,4H2,(H,23,24)/t10-,12-,13-,14-/m1/s1 |
| InChIKey | HGCYMWSCFIUSKJ-FMKGYKFTSA-N |
| XLogP | 0.62 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |