C16H25N5O6 — CID 136622900
[(2R,3S,4R,5R)-5-(2-amino-4-oxo-5,6-dihydro-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 136622900) has the molecular formula C16H25N5O6 and a molecular weight of 383.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-4-oxo-5,6-dihydro-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-4-oxo-5,6-dihydro-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 136622900 |
| Molecular Formula | C16H25N5O6 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-4-oxo-5,6-dihydro-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OC[C@H]1O[C@@H](N2CCc3c2nc(N)[nH]c3=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H25N5O6/c1-6(2)9(17)15(25)26-5-8-10(22)11(23)14(27-8)21-4-3-7-12(21)19-16(18)20-13(7)24/h6,8-11,14,22-23H,3-5,17H2,1-2H3,(H3,18,19,20,24)/t8-,9+,10-,11-,14-/m1/s1 |
| InChIKey | JYZIFMQZUQFDOJ-AYDOGRCQSA-N |
| XLogP | -2.31 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |