C14H23N5O6 — CID 164541203
[(2R,4S,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl (3R)-2-amino-3-methylpentanoate (PubChem CID 164541203) has the molecular formula C14H23N5O6 and a molecular weight of 357.37 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl (3R)-2-amino-3-methylpentanoate.
| Compound Name | [(2R,4S,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl (3R)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 164541203 |
| Molecular Formula | C14H23N5O6 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [(2R,4S,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl (3R)-2-amino-3-methylpentanoate |
| SMILES | CC[C@@H](C)C(N)C(=O)OC[C@H]1O[C@@H](n2ncc(N)nc2=O)[C@@H](O)C1O |
| InChI | InChI=1S/C14H23N5O6/c1-3-6(2)9(16)13(22)24-5-7-10(20)11(21)12(25-7)19-14(23)18-8(15)4-17-19/h4,6-7,9-12,20-21H,3,5,16H2,1-2H3,(H2,15,18,23)/t6-,7-,9?,10?,11+,12-/m1/s1 |
| InChIKey | ULAYCMQSSRIYPC-GSWBDQLXSA-N |
| XLogP | -2.24 |
| TPSA | 175.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |