C8H12N4O6 — CID 137221145
2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(hydroxyamino)-1,2,4-triazin-3-one (PubChem CID 137221145) has the molecular formula C8H12N4O6 and a molecular weight of 260.21 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(hydroxyamino)-1,2,4-triazin-3-one.
| Compound Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(hydroxyamino)-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 137221145 |
| Molecular Formula | C8H12N4O6 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(hydroxyamino)-1,2,4-triazin-3-one |
| SMILES | O=c1nc(NO)cnn1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H12N4O6/c13-2-3-5(14)6(15)7(18-3)12-8(16)10-4(11-17)1-9-12/h1,3,5-7,13-15,17H,2H2,(H,10,11,16)/t3-,5-,6-,7-/m1/s1 |
| InChIKey | MFWQZOOSIZPUQD-SHUUEZRQSA-N |
| XLogP | -2.95 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|