C8H11N3O6 — CID 7200516
2-[(2R,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione (PubChem CID 7200516) has the molecular formula C8H11N3O6 and a molecular weight of 245.19 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[(2R,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 7200516 |
| Molecular Formula | C8H11N3O6 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[(2R,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn([C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3O6/c12-2-3-5(14)6(15)7(17-3)11-8(16)10-4(13)1-9-11/h1,3,5-7,12,14-15H,2H2,(H,10,13,16)/t3-,5+,6-,7+/m0/s1 |
| InChIKey | WYXSYVWAUAUWLD-HTPUFBNKSA-N |
| XLogP | -3.46 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |