C10H15N3O10S2 — CID 102504484
[(2R,3R,4R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-2-(hydroxymethyl)-4-methylsulfonyloxyoxolan-3-yl] methanesulfonate (PubChem CID 102504484) has the molecular formula C10H15N3O10S2 and a molecular weight of 401.38 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-2-(hydroxymethyl)-4-methylsulfonyloxyoxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-2-(hydroxymethyl)-4-methylsulfonyloxyoxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 102504484 |
| Molecular Formula | C10H15N3O10S2 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-2-(hydroxymethyl)-4-methylsulfonyloxyoxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@H](OS(C)(=O)=O)[C@@H](CO)O[C@H]1n1ncc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O10S2/c1-24(17,18)22-7-5(4-14)21-9(8(7)23-25(2,19)20)13-10(16)12-6(15)3-11-13/h3,5,7-9,14H,4H2,1-2H3,(H,12,15,16)/t5-,7-,8-,9-/m1/s1 |
| InChIKey | LRHSFVQXZYEVIG-ZOQUXTDFSA-N |
| XLogP | -3.49 |
| TPSA | 183.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|