C16H23Cl2N4O10P — CID 53431035
N,N-bis(2-chloroethyl)-[[3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy]phosphonamidic acid (PubChem CID 53431035) has the molecular formula C16H23Cl2N4O10P and a molecular weight of 533.26 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-[[3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy]phosphonamidic acid.
| Compound Name | N,N-bis(2-chloroethyl)-[[3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy]phosphonamidic acid |
|---|---|
| PubChem CID | 53431035 |
| Molecular Formula | C16H23Cl2N4O10P |
| Molecular Weight | 533.26 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | N,N-bis(2-chloroethyl)-[[3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methoxy]phosphonamidic acid |
| SMILES | CC(=O)OC1C(COP(=O)(O)N(CCCl)CCCl)OC(n2ncc(=O)[nH]c2=O)C1OC(C)=O |
| InChI | InChI=1S/C16H23Cl2N4O10P/c1-9(23)30-13-11(8-29-33(27,28)21(5-3-17)6-4-18)32-15(14(13)31-10(2)24)22-16(26)20-12(25)7-19-22/h7,11,13-15H,3-6,8H2,1-2H3,(H,27,28)(H,20,25,26) |
| InChIKey | IGQSSGGXXFGWDN-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 179.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.26 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|