C18H24N4O8 — CID 23253541
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[5-(dimethylaminomethylideneamino)-4-formylpyrazol-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 23253541) has the molecular formula C18H24N4O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[5-(dimethylaminomethylideneamino)-4-formylpyrazol-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[5-(dimethylaminomethylideneamino)-4-formylpyrazol-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23253541 |
| Molecular Formula | C18H24N4O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[5-(dimethylaminomethylideneamino)-4-formylpyrazol-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ncc(C=O)c2N=CN(C)C)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H24N4O8/c1-10(24)27-8-14-15(28-11(2)25)16(29-12(3)26)18(30-14)22-17(19-9-21(4)5)13(7-23)6-20-22/h6-7,9,14-16,18H,8H2,1-5H3/t14-,15-,16-,18-/m1/s1 |
| InChIKey | BHSVFRHRKNPXSG-YFHUEUNASA-N |
| XLogP | 0.24 |
| TPSA | 138.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|